C21H19N7O4 — CID 136831186
(8R)-8-(2,4-dimethoxyphenyl)-10-(4-methoxyphenyl)-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one (PubChem CID 136831186) has the molecular formula C21H19N7O4 and a molecular weight of 433.43 g/mol. Its IUPAC name is (8R)-8-(2,4-dimethoxyphenyl)-10-(4-methoxyphenyl)-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one.
| Compound Name | (8R)-8-(2,4-dimethoxyphenyl)-10-(4-methoxyphenyl)-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
|---|---|
| PubChem CID | 136831186 |
| Molecular Formula | C21H19N7O4 |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | (8R)-8-(2,4-dimethoxyphenyl)-10-(4-methoxyphenyl)-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
| SMILES | COc1ccc(-c2n[nH]c(=O)c3c2[C@H](c2ccc(OC)cc2OC)n2nnnc2N3)cc1 |
| InChI | InChI=1S/C21H19N7O4/c1-30-12-6-4-11(5-7-12)17-16-18(20(29)24-23-17)22-21-25-26-27-28(21)19(16)14-9-8-13(31-2)10-15(14)32-3/h4-10,19H,1-3H3,(H,24,29)(H,22,25,27)/t19-/m0/s1 |
| InChIKey | QUEXYFBMOCMKFY-IBGZPJMESA-N |
| XLogP | 2.14 |
| TPSA | 129.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |