C20H17N7O3 — CID 135715319
8-(2,4-dimethoxyphenyl)-10-phenyl-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one (PubChem CID 135715319) has the molecular formula C20H17N7O3 and a molecular weight of 403.40 g/mol. Its IUPAC name is 8-(2,4-dimethoxyphenyl)-10-phenyl-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one.
| Compound Name | 8-(2,4-dimethoxyphenyl)-10-phenyl-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
|---|---|
| PubChem CID | 135715319 |
| Molecular Formula | C20H17N7O3 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 8-(2,4-dimethoxyphenyl)-10-phenyl-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
| SMILES | COc1ccc(C2c3c(-c4ccccc4)n[nH]c(=O)c3Nc3nnnn32)c(OC)c1 |
| InChI | InChI=1S/C20H17N7O3/c1-29-12-8-9-13(14(10-12)30-2)18-15-16(11-6-4-3-5-7-11)22-23-19(28)17(15)21-20-24-25-26-27(18)20/h3-10,18H,1-2H3,(H,23,28)(H,21,24,26) |
| InChIKey | SWWAPBZKZPOLAO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |