C18H15N7O3S — CID 136831394
(8R)-8-(2,4-dimethoxyphenyl)-10-thiophen-2-yl-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one (PubChem CID 136831394) has the molecular formula C18H15N7O3S and a molecular weight of 409.43 g/mol. Its IUPAC name is (8R)-8-(2,4-dimethoxyphenyl)-10-thiophen-2-yl-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one.
| Compound Name | (8R)-8-(2,4-dimethoxyphenyl)-10-thiophen-2-yl-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
|---|---|
| PubChem CID | 136831394 |
| Molecular Formula | C18H15N7O3S |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | (8R)-8-(2,4-dimethoxyphenyl)-10-thiophen-2-yl-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
| SMILES | COc1ccc([C@H]2c3c(-c4cccs4)n[nH]c(=O)c3Nc3nnnn32)c(OC)c1 |
| InChI | InChI=1S/C18H15N7O3S/c1-27-9-5-6-10(11(8-9)28-2)16-13-14(12-4-3-7-29-12)20-21-17(26)15(13)19-18-22-23-24-25(16)18/h3-8,16H,1-2H3,(H,21,26)(H,19,22,24)/t16-/m0/s1 |
| InChIKey | LBOSDEFHZDAZJC-INIZCTEOSA-N |
| XLogP | 2.20 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |