C14H9N7OS2 — CID 137076212
(8S)-8,10-dithiophen-2-yl-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one (PubChem CID 137076212) has the molecular formula C14H9N7OS2 and a molecular weight of 355.41 g/mol. Its IUPAC name is (8S)-8,10-dithiophen-2-yl-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one.
| Compound Name | (8S)-8,10-dithiophen-2-yl-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
|---|---|
| PubChem CID | 137076212 |
| Molecular Formula | C14H9N7OS2 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | (8S)-8,10-dithiophen-2-yl-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
| SMILES | O=c1[nH]nc(-c2cccs2)c2c1Nc1nnnn1[C@@H]2c1cccs1 |
| InChI | InChI=1S/C14H9N7OS2/c22-13-11-9(10(16-17-13)7-3-1-5-23-7)12(8-4-2-6-24-8)21-14(15-11)18-19-20-21/h1-6,12H,(H,17,22)(H,15,18,20)/t12-/m1/s1 |
| InChIKey | IZHDTXLVFHTYBN-GFCCVEGCSA-N |
| XLogP | 2.24 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |