C17H12N8O — CID 135715329
10-phenyl-8-pyridin-2-yl-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one (PubChem CID 135715329) has the molecular formula C17H12N8O and a molecular weight of 344.34 g/mol. Its IUPAC name is 10-phenyl-8-pyridin-2-yl-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one.
| Compound Name | 10-phenyl-8-pyridin-2-yl-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
|---|---|
| PubChem CID | 135715329 |
| Molecular Formula | C17H12N8O |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 10-phenyl-8-pyridin-2-yl-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
| SMILES | O=c1[nH]nc(-c2ccccc2)c2c1Nc1nnnn1C2c1ccccn1 |
| InChI | InChI=1S/C17H12N8O/c26-16-14-12(13(20-21-16)10-6-2-1-3-7-10)15(11-8-4-5-9-18-11)25-17(19-14)22-23-24-25/h1-9,15H,(H,21,26)(H,19,22,24) |
| InChIKey | UDPNFUCXZVRLSG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |