C18H12ClN7O — CID 136831122
(8R)-10-(4-chlorophenyl)-8-phenyl-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one (PubChem CID 136831122) has the molecular formula C18H12ClN7O and a molecular weight of 377.80 g/mol. Its IUPAC name is (8R)-10-(4-chlorophenyl)-8-phenyl-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one.
| Compound Name | (8R)-10-(4-chlorophenyl)-8-phenyl-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
|---|---|
| PubChem CID | 136831122 |
| Molecular Formula | C18H12ClN7O |
| Molecular Weight | 377.80 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | (8R)-10-(4-chlorophenyl)-8-phenyl-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
| SMILES | O=c1[nH]nc(-c2ccc(Cl)cc2)c2c1Nc1nnnn1[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C18H12ClN7O/c19-12-8-6-10(7-9-12)14-13-15(17(27)22-21-14)20-18-23-24-25-26(18)16(13)11-4-2-1-3-5-11/h1-9,16H,(H,22,27)(H,20,23,25)/t16-/m1/s1 |
| InChIKey | SDGIZBVTGPRHSF-MRXNPFEDSA-N |
| XLogP | 2.77 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.80 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |