C18H11ClFN7O — CID 135957208
(8S)-8-(2-chlorophenyl)-10-(4-fluorophenyl)-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one (PubChem CID 135957208) has the molecular formula C18H11ClFN7O and a molecular weight of 395.79 g/mol. Its IUPAC name is (8S)-8-(2-chlorophenyl)-10-(4-fluorophenyl)-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one.
| Compound Name | (8S)-8-(2-chlorophenyl)-10-(4-fluorophenyl)-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
|---|---|
| PubChem CID | 135957208 |
| Molecular Formula | C18H11ClFN7O |
| Molecular Weight | 395.79 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | (8S)-8-(2-chlorophenyl)-10-(4-fluorophenyl)-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
| SMILES | O=c1[nH]nc(-c2ccc(F)cc2)c2c1Nc1nnnn1[C@@H]2c1ccccc1Cl |
| InChI | InChI=1S/C18H11ClFN7O/c19-12-4-2-1-3-11(12)16-13-14(9-5-7-10(20)8-6-9)22-23-17(28)15(13)21-18-24-25-26-27(16)18/h1-8,16H,(H,23,28)(H,21,24,26)/t16-/m1/s1 |
| InChIKey | GGIJGLPVBXSPFO-MRXNPFEDSA-N |
| XLogP | 2.91 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.79 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |