C18H11BrN8O3 — CID 137157623
(8R)-10-(4-bromophenyl)-8-(2-nitrophenyl)-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one (PubChem CID 137157623) has the molecular formula C18H11BrN8O3 and a molecular weight of 467.24 g/mol. Its IUPAC name is (8R)-10-(4-bromophenyl)-8-(2-nitrophenyl)-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one.
| Compound Name | (8R)-10-(4-bromophenyl)-8-(2-nitrophenyl)-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
|---|---|
| PubChem CID | 137157623 |
| Molecular Formula | C18H11BrN8O3 |
| Molecular Weight | 467.24 g/mol |
| Exact Mass | 466.01 |
| IUPAC Name | (8R)-10-(4-bromophenyl)-8-(2-nitrophenyl)-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
| SMILES | O=c1[nH]nc(-c2ccc(Br)cc2)c2c1Nc1nnnn1[C@@H]2c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H11BrN8O3/c19-10-7-5-9(6-8-10)14-13-15(17(28)22-21-14)20-18-23-24-25-26(18)16(13)11-3-1-2-4-12(11)27(29)30/h1-8,16H,(H,22,28)(H,20,23,25)/t16-/m1/s1 |
| InChIKey | HZYHVYUMJGVSII-MRXNPFEDSA-N |
| XLogP | 2.79 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.24 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|