C18H12N8O4 — CID 136831235
(8R)-8-(3-hydroxyphenyl)-10-(4-nitrophenyl)-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one (PubChem CID 136831235) has the molecular formula C18H12N8O4 and a molecular weight of 404.35 g/mol. Its IUPAC name is (8R)-8-(3-hydroxyphenyl)-10-(4-nitrophenyl)-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one.
| Compound Name | (8R)-8-(3-hydroxyphenyl)-10-(4-nitrophenyl)-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
|---|---|
| PubChem CID | 136831235 |
| Molecular Formula | C18H12N8O4 |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | (8R)-8-(3-hydroxyphenyl)-10-(4-nitrophenyl)-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
| SMILES | O=c1[nH]nc(-c2ccc([N+](=O)[O-])cc2)c2c1Nc1nnnn1[C@@H]2c1cccc(O)c1 |
| InChI | InChI=1S/C18H12N8O4/c27-12-3-1-2-10(8-12)16-13-14(9-4-6-11(7-5-9)26(29)30)20-21-17(28)15(13)19-18-22-23-24-25(16)18/h1-8,16,27H,(H,21,28)(H,19,22,24)/t16-/m1/s1 |
| InChIKey | CDOWBHQHMKLAMN-MRXNPFEDSA-N |
| XLogP | 1.73 |
| TPSA | 164.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|