C16H11N7O2S — CID 137076214
(8R)-8-(3-hydroxyphenyl)-10-thiophen-2-yl-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one (PubChem CID 137076214) has the molecular formula C16H11N7O2S and a molecular weight of 365.38 g/mol. Its IUPAC name is (8R)-8-(3-hydroxyphenyl)-10-thiophen-2-yl-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one.
| Compound Name | (8R)-8-(3-hydroxyphenyl)-10-thiophen-2-yl-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
|---|---|
| PubChem CID | 137076214 |
| Molecular Formula | C16H11N7O2S |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | (8R)-8-(3-hydroxyphenyl)-10-thiophen-2-yl-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
| SMILES | O=c1[nH]nc(-c2cccs2)c2c1Nc1nnnn1[C@@H]2c1cccc(O)c1 |
| InChI | InChI=1S/C16H11N7O2S/c24-9-4-1-3-8(7-9)14-11-12(10-5-2-6-26-10)18-19-15(25)13(11)17-16-20-21-22-23(14)16/h1-7,14,24H,(H,19,25)(H,17,20,22)/t14-/m1/s1 |
| InChIKey | POWXZMNZQSAZDB-CQSZACIVSA-N |
| XLogP | 1.89 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |