C22H20FN7O — CID 136822629
(8R)-8-(4-tert-butylphenyl)-10-(4-fluorophenyl)-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one (PubChem CID 136822629) has the molecular formula C22H20FN7O and a molecular weight of 417.45 g/mol. Its IUPAC name is (8R)-8-(4-tert-butylphenyl)-10-(4-fluorophenyl)-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one.
| Compound Name | (8R)-8-(4-tert-butylphenyl)-10-(4-fluorophenyl)-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
|---|---|
| PubChem CID | 136822629 |
| Molecular Formula | C22H20FN7O |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | (8R)-8-(4-tert-butylphenyl)-10-(4-fluorophenyl)-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
| SMILES | CC(C)(C)c1ccc([C@@H]2c3c(-c4ccc(F)cc4)n[nH]c(=O)c3Nc3nnnn32)cc1 |
| InChI | InChI=1S/C22H20FN7O/c1-22(2,3)14-8-4-13(5-9-14)19-16-17(12-6-10-15(23)11-7-12)25-26-20(31)18(16)24-21-27-28-29-30(19)21/h4-11,19H,1-3H3,(H,26,31)(H,24,27,29)/t19-/m1/s1 |
| InChIKey | VRWFPBQYYPBSCR-LJQANCHMSA-N |
| XLogP | 3.55 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |