C22H19Cl2N7O — CID 137076296
(8R)-8-(4-tert-butylphenyl)-10-(2,4-dichlorophenyl)-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one (PubChem CID 137076296) has the molecular formula C22H19Cl2N7O and a molecular weight of 468.35 g/mol. Its IUPAC name is (8R)-8-(4-tert-butylphenyl)-10-(2,4-dichlorophenyl)-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one.
| Compound Name | (8R)-8-(4-tert-butylphenyl)-10-(2,4-dichlorophenyl)-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
|---|---|
| PubChem CID | 137076296 |
| Molecular Formula | C22H19Cl2N7O |
| Molecular Weight | 468.35 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | (8R)-8-(4-tert-butylphenyl)-10-(2,4-dichlorophenyl)-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
| SMILES | CC(C)(C)c1ccc([C@@H]2c3c(-c4ccc(Cl)cc4Cl)n[nH]c(=O)c3Nc3nnnn32)cc1 |
| InChI | InChI=1S/C22H19Cl2N7O/c1-22(2,3)12-6-4-11(5-7-12)19-16-17(14-9-8-13(23)10-15(14)24)26-27-20(32)18(16)25-21-28-29-30-31(19)21/h4-10,19H,1-3H3,(H,27,32)(H,25,28,30)/t19-/m1/s1 |
| InChIKey | FMCUXJOYGQCGFR-LJQANCHMSA-N |
| XLogP | 4.72 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.35 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |