C20H15Cl2N7O3 — CID 137076300
(8S)-10-(2,4-dichlorophenyl)-8-(2,5-dimethoxyphenyl)-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one (PubChem CID 137076300) has the molecular formula C20H15Cl2N7O3 and a molecular weight of 472.29 g/mol. Its IUPAC name is (8S)-10-(2,4-dichlorophenyl)-8-(2,5-dimethoxyphenyl)-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one.
| Compound Name | (8S)-10-(2,4-dichlorophenyl)-8-(2,5-dimethoxyphenyl)-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
|---|---|
| PubChem CID | 137076300 |
| Molecular Formula | C20H15Cl2N7O3 |
| Molecular Weight | 472.29 g/mol |
| Exact Mass | 471.06 |
| IUPAC Name | (8S)-10-(2,4-dichlorophenyl)-8-(2,5-dimethoxyphenyl)-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
| SMILES | COc1ccc(OC)c([C@@H]2c3c(-c4ccc(Cl)cc4Cl)n[nH]c(=O)c3Nc3nnnn32)c1 |
| InChI | InChI=1S/C20H15Cl2N7O3/c1-31-10-4-6-14(32-2)12(8-10)18-15-16(11-5-3-9(21)7-13(11)22)24-25-19(30)17(15)23-20-26-27-28-29(18)20/h3-8,18H,1-2H3,(H,25,30)(H,23,26,28)/t18-/m1/s1 |
| InChIKey | WNGRQZJSLYORIR-GOSISDBHSA-N |
| XLogP | 3.44 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.29 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |