C21H26N2O5 — CID 7412596
cyclooctyl (4R)-6-methyl-4-(2-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyridine-5-carboxylate (PubChem CID 7412596) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is cyclooctyl (4R)-6-methyl-4-(2-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyridine-5-carboxylate.
| Compound Name | cyclooctyl (4R)-6-methyl-4-(2-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyridine-5-carboxylate |
|---|---|
| PubChem CID | 7412596 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | cyclooctyl (4R)-6-methyl-4-(2-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyridine-5-carboxylate |
| SMILES | CC1=C(C(=O)OC2CCCCCCC2)[C@@H](c2ccccc2[N+](=O)[O-])CC(=O)N1 |
| InChI | InChI=1S/C21H26N2O5/c1-14-20(21(25)28-15-9-5-3-2-4-6-10-15)17(13-19(24)22-14)16-11-7-8-12-18(16)23(26)27/h7-8,11-12,15,17H,2-6,9-10,13H2,1H3,(H,22,24)/t17-/m1/s1 |
| InChIKey | KEMISNIEEGTGIH-QGZVFWFLSA-N |
| XLogP | 4.13 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|