C20H24N2O5 — CID 7412704
cycloheptyl (4S)-6-methyl-4-(2-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyridine-5-carboxylate (PubChem CID 7412704) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is cycloheptyl (4S)-6-methyl-4-(2-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyridine-5-carboxylate.
| Compound Name | cycloheptyl (4S)-6-methyl-4-(2-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyridine-5-carboxylate |
|---|---|
| PubChem CID | 7412704 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | cycloheptyl (4S)-6-methyl-4-(2-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyridine-5-carboxylate |
| SMILES | CC1=C(C(=O)OC2CCCCCC2)[C@H](c2ccccc2[N+](=O)[O-])CC(=O)N1 |
| InChI | InChI=1S/C20H24N2O5/c1-13-19(20(24)27-14-8-4-2-3-5-9-14)16(12-18(23)21-13)15-10-6-7-11-17(15)22(25)26/h6-7,10-11,14,16H,2-5,8-9,12H2,1H3,(H,21,23)/t16-/m0/s1 |
| InChIKey | HOYBASCFOJZPSD-INIZCTEOSA-N |
| XLogP | 3.74 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|