C12H9ClN2OS — CID 789546
(4S)-4-(2-chlorophenyl)-2-oxo-6-sulfanyl-3,4-dihydro-1H-pyridine-5-carbonitrile (PubChem CID 789546) has the molecular formula C12H9ClN2OS and a molecular weight of 264.74 g/mol. Its IUPAC name is (4S)-4-(2-chlorophenyl)-2-oxo-6-sulfanyl-3,4-dihydro-1H-pyridine-5-carbonitrile.
| Compound Name | (4S)-4-(2-chlorophenyl)-2-oxo-6-sulfanyl-3,4-dihydro-1H-pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 789546 |
| Molecular Formula | C12H9ClN2OS |
| Molecular Weight | 264.74 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | (4S)-4-(2-chlorophenyl)-2-oxo-6-sulfanyl-3,4-dihydro-1H-pyridine-5-carbonitrile |
| SMILES | N#CC1=C(S)NC(=O)C[C@@H]1c1ccccc1Cl |
| InChI | InChI=1S/C12H9ClN2OS/c13-10-4-2-1-3-7(10)8-5-11(16)15-12(17)9(8)6-14/h1-4,8,17H,5H2,(H,15,16)/t8-/m1/s1 |
| InChIKey | GWXBVHXMWBYSCL-MRVPVSSYSA-N |
| XLogP | 2.61 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.74 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|