C18H21ClN2OS — CID 7064195
(4R)-4-(2-chlorophenyl)-6-hexylsulfanyl-2-oxo-3,4-dihydro-1H-pyridine-5-carbonitrile (PubChem CID 7064195) has the molecular formula C18H21ClN2OS and a molecular weight of 348.90 g/mol. Its IUPAC name is (4R)-4-(2-chlorophenyl)-6-hexylsulfanyl-2-oxo-3,4-dihydro-1H-pyridine-5-carbonitrile.
| Compound Name | (4R)-4-(2-chlorophenyl)-6-hexylsulfanyl-2-oxo-3,4-dihydro-1H-pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 7064195 |
| Molecular Formula | C18H21ClN2OS |
| Molecular Weight | 348.90 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | (4R)-4-(2-chlorophenyl)-6-hexylsulfanyl-2-oxo-3,4-dihydro-1H-pyridine-5-carbonitrile |
| SMILES | CCCCCCSC1=C(C#N)[C@H](c2ccccc2Cl)CC(=O)N1 |
| InChI | InChI=1S/C18H21ClN2OS/c1-2-3-4-7-10-23-18-15(12-20)14(11-17(22)21-18)13-8-5-6-9-16(13)19/h5-6,8-9,14H,2-4,7,10-11H2,1H3,(H,21,22)/t14-/m0/s1 |
| InChIKey | UBORDBSQEKLOTR-AWEZNQCLSA-N |
| XLogP | 4.99 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.90 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|