C19H21ClN2OS — CID 27745167
(4R)-5-acetyl-2-butylsulfanyl-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3-carbonitrile (PubChem CID 27745167) has the molecular formula C19H21ClN2OS and a molecular weight of 360.91 g/mol. Its IUPAC name is (4R)-5-acetyl-2-butylsulfanyl-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3-carbonitrile.
| Compound Name | (4R)-5-acetyl-2-butylsulfanyl-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3-carbonitrile |
|---|---|
| PubChem CID | 27745167 |
| Molecular Formula | C19H21ClN2OS |
| Molecular Weight | 360.91 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | (4R)-5-acetyl-2-butylsulfanyl-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3-carbonitrile |
| SMILES | CCCCSC1=C(C#N)[C@H](c2ccccc2Cl)C(C(C)=O)=C(C)N1 |
| InChI | InChI=1S/C19H21ClN2OS/c1-4-5-10-24-19-15(11-21)18(14-8-6-7-9-16(14)20)17(13(3)23)12(2)22-19/h6-9,18,22H,4-5,10H2,1-3H3/t18-/m0/s1 |
| InChIKey | CGMZZAJKYJETHJ-SFHVURJKSA-N |
| XLogP | 5.16 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.91 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|