C24H24ClN3OS — CID 28717769
(4S)-6-butylsulfanyl-4-(2-chlorophenyl)-5-cyano-2-methyl-N-phenyl-1,4-dihydropyridine-3-carboxamide (PubChem CID 28717769) has the molecular formula C24H24ClN3OS and a molecular weight of 438.00 g/mol. Its IUPAC name is (4S)-6-butylsulfanyl-4-(2-chlorophenyl)-5-cyano-2-methyl-N-phenyl-1,4-dihydropyridine-3-carboxamide.
| Compound Name | (4S)-6-butylsulfanyl-4-(2-chlorophenyl)-5-cyano-2-methyl-N-phenyl-1,4-dihydropyridine-3-carboxamide |
|---|---|
| PubChem CID | 28717769 |
| Molecular Formula | C24H24ClN3OS |
| Molecular Weight | 438.00 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | (4S)-6-butylsulfanyl-4-(2-chlorophenyl)-5-cyano-2-methyl-N-phenyl-1,4-dihydropyridine-3-carboxamide |
| SMILES | CCCCSC1=C(C#N)[C@@H](c2ccccc2Cl)C(C(=O)Nc2ccccc2)=C(C)N1 |
| InChI | InChI=1S/C24H24ClN3OS/c1-3-4-14-30-24-19(15-26)22(18-12-8-9-13-20(18)25)21(16(2)27-24)23(29)28-17-10-6-5-7-11-17/h5-13,22,27H,3-4,14H2,1-2H3,(H,28,29)/t22-/m1/s1 |
| InChIKey | UFBUQVPCRVJZAJ-JOCHJYFZSA-N |
| XLogP | 6.21 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.00 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|