C10H10N2O4S — CID 71651869
4-(2-nitrophenyl)-1,3-thiazolidine-2-carboxylic acid (PubChem CID 71651869) has the molecular formula C10H10N2O4S and a molecular weight of 254.27 g/mol. Its IUPAC name is 4-(2-nitrophenyl)-1,3-thiazolidine-2-carboxylic acid.
| Compound Name | 4-(2-nitrophenyl)-1,3-thiazolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 71651869 |
| Molecular Formula | C10H10N2O4S |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 4-(2-nitrophenyl)-1,3-thiazolidine-2-carboxylic acid |
| SMILES | O=C(O)C1NC(c2ccccc2[N+](=O)[O-])CS1 |
| InChI | InChI=1S/C10H10N2O4S/c13-10(14)9-11-7(5-17-9)6-3-1-2-4-8(6)12(15)16/h1-4,7,9,11H,5H2,(H,13,14) |
| InChIKey | XSUDFCCNTACKEZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|