C11H13NO2S — CID 93020089
(2R,4S)-4-(3-methylphenyl)-1,3-thiazolidine-2-carboxylic acid (PubChem CID 93020089) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is (2R,4S)-4-(3-methylphenyl)-1,3-thiazolidine-2-carboxylic acid.
| Compound Name | (2R,4S)-4-(3-methylphenyl)-1,3-thiazolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 93020089 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | (2R,4S)-4-(3-methylphenyl)-1,3-thiazolidine-2-carboxylic acid |
| SMILES | Cc1cccc([C@H]2CS[C@H](C(=O)O)N2)c1 |
| InChI | InChI=1S/C11H13NO2S/c1-7-3-2-4-8(5-7)9-6-15-10(12-9)11(13)14/h2-5,9-10,12H,6H2,1H3,(H,13,14)/t9-,10-/m1/s1 |
| InChIKey | QIYIGPHEXARMPU-NXEZZACHSA-N |
| XLogP | 1.78 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |