C13H16O2 — CID 95438610
trans-(1R,3R)-3-(3-methylphenyl)cyclopentane-1-carboxylic acid (PubChem CID 95438610) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is trans-(1R,3R)-3-(3-methylphenyl)cyclopentane-1-carboxylic acid.
| Compound Name | trans-(1R,3R)-3-(3-methylphenyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 95438610 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | trans-(1R,3R)-3-(3-methylphenyl)cyclopentane-1-carboxylic acid |
| SMILES | Cc1cccc([C@@H]2CC[C@@H](C(=O)O)C2)c1 |
| InChI | InChI=1S/C13H16O2/c1-9-3-2-4-10(7-9)11-5-6-12(8-11)13(14)15/h2-4,7,11-12H,5-6,8H2,1H3,(H,14,15)/t11-,12-/m1/s1 |
| InChIKey | KTCBGPZTPJVIRP-VXGBXAGGSA-N |
| XLogP | 2.96 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |