C14H19Cl — CID 64506624
1-chloro-3-(3-methylphenyl)cycloheptane (PubChem CID 64506624) has the molecular formula C14H19Cl and a molecular weight of 222.76 g/mol. Its IUPAC name is 1-chloro-3-(3-methylphenyl)cycloheptane.
| Compound Name | 1-chloro-3-(3-methylphenyl)cycloheptane |
|---|---|
| PubChem CID | 64506624 |
| Molecular Formula | C14H19Cl |
| Molecular Weight | 222.76 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 1-chloro-3-(3-methylphenyl)cycloheptane |
| SMILES | Cc1cccc(C2CCCCC(Cl)C2)c1 |
| InChI | InChI=1S/C14H19Cl/c1-11-5-4-7-12(9-11)13-6-2-3-8-14(15)10-13/h4-5,7,9,13-14H,2-3,6,8,10H2,1H3 |
| InChIKey | IBBMTIHQFQASQA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.76 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|