About cyclopropanecarboxylic acid;1-fluoro-3-methylbenzene
cyclopropanecarboxylic acid;1-fluoro-3-methylbenzene (PubChem CID 144506974) has the molecular formula C11H13FO2
and a molecular weight of 196.22 g/mol. Its IUPAC name is cyclopropanecarboxylic acid;1-fluoro-3-methylbenzene.
Molecular Properties
| Compound Name | cyclopropanecarboxylic acid;1-fluoro-3-methylbenzene |
| PubChem CID | 144506974 |
| Molecular Formula | C11H13FO2 |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | cyclopropanecarboxylic acid;1-fluoro-3-methylbenzene |
| SMILES | Cc1cccc(F)c1.O=C(O)C1CC1 |
| InChI | InChI=1S/C7H7F.C4H6O2/c1-6-3-2-4-7(8)5-6;5-4(6)3-1-2-3/h2-5H,1H3;3H,1-2H2,(H,5,6) |
| InChIKey | TWMZCEJNFMFNTP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclopropanecarboxylic acid;1-fluoro-3-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropanecarboxylic acid;1-fluoro-3-methylbenzene?
The IUPAC name of cyclopropanecarboxylic acid;1-fluoro-3-methylbenzene (CID 144506974) is cyclopropanecarboxylic acid;1-fluoro-3-methylbenzene.
What is the SMILES notation for cyclopropanecarboxylic acid;1-fluoro-3-methylbenzene?
The canonical SMILES for cyclopropanecarboxylic acid;1-fluoro-3-methylbenzene is Cc1cccc(F)c1.O=C(O)C1CC1.
What is the InChIKey of cyclopropanecarboxylic acid;1-fluoro-3-methylbenzene?
The InChIKey is TWMZCEJNFMFNTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F.C4H6O2/c1-6-3-2-4-7(8)5-6;5-4(6)3-1-2-3/h2-5H,1H3;3H,1-2H2,(H,5,6).
What are the key properties of cyclopropanecarboxylic acid;1-fluoro-3-methylbenzene?
cyclopropanecarboxylic acid;1-fluoro-3-methylbenzene has a molecular weight of 196.22 g/mol, XLogP of 2.62, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropanecarboxylic acid;1-fluoro-3-methylbenzene is sourced from PubChem (CID 144506974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).