C13H14NO3S- — CID 6948542
(2R,4R)-3-acetyl-2-(3-methylphenyl)-1,3-thiazolidine-4-carboxylate (PubChem CID 6948542) has the molecular formula C13H14NO3S- and a molecular weight of 264.33 g/mol. Its IUPAC name is (2R,4R)-3-acetyl-2-(3-methylphenyl)-1,3-thiazolidine-4-carboxylate.
| Compound Name | (2R,4R)-3-acetyl-2-(3-methylphenyl)-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 6948542 |
| Molecular Formula | C13H14NO3S- |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | (2R,4R)-3-acetyl-2-(3-methylphenyl)-1,3-thiazolidine-4-carboxylate |
| SMILES | CC(=O)N1[C@@H](c2cccc(C)c2)SC[C@H]1C(=O)[O-] |
| InChI | InChI=1S/C13H15NO3S/c1-8-4-3-5-10(6-8)12-14(9(2)15)11(7-18-12)13(16)17/h3-6,11-12H,7H2,1-2H3,(H,16,17)/p-1/t11-,12+/m0/s1 |
| InChIKey | NSPMXKUWUQZFIF-NWDGAFQWSA-M |
| XLogP | 0.71 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |