C12H11Cl2NO3S — CID 19579691
3-acetyl-2-(2,6-dichlorophenyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 19579691) has the molecular formula C12H11Cl2NO3S and a molecular weight of 320.20 g/mol. Its IUPAC name is 3-acetyl-2-(2,6-dichlorophenyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 3-acetyl-2-(2,6-dichlorophenyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 19579691 |
| Molecular Formula | C12H11Cl2NO3S |
| Molecular Weight | 320.20 g/mol |
| Exact Mass | 318.98 |
| IUPAC Name | 3-acetyl-2-(2,6-dichlorophenyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CC(=O)N1C(C(=O)O)CSC1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H11Cl2NO3S/c1-6(16)15-9(12(17)18)5-19-11(15)10-7(13)3-2-4-8(10)14/h2-4,9,11H,5H2,1H3,(H,17,18) |
| InChIKey | MSLQNFMAKJGKIV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.20 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |