(2R,4R)-3-acetyl-2-phenyl-1,3-thiazolidine-4-carboxylic acid

C12H13NO3S — CID 759136

IUPAC(2R,4R)-3-acetyl-2-phenyl-1,3-thiazolidine-4-carboxylic acid
SMILESCC(=O)N1[C@@H](c2ccccc2)SC[C@H]1C(=O)O
InChIInChI=1S/C12H13NO3S/c1-8(14)13-10(12(15)16)7-17-11(13)9-5-3-2-4-6-9/h2-6,10-11H,7H2,1H3,(H,15,16)/t10-,11+/m0/s1
InChIKeyNYATUQLQYZIJCY-WDEREUQCSA-N
MW251.31 g/mol
LogP1.73
Rot. Bonds2

About (2R,4R)-3-acetyl-2-phenyl-1,3-thiazolidine-4-carboxylic acid

(2R,4R)-3-acetyl-2-phenyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 759136) has the molecular formula C12H13NO3S and a molecular weight of 251.31 g/mol. Its IUPAC name is (2R,4R)-3-acetyl-2-phenyl-1,3-thiazolidine-4-carboxylic acid.

Molecular Properties

Compound Name(2R,4R)-3-acetyl-2-phenyl-1,3-thiazolidine-4-carboxylic acid
PubChem CID759136
Molecular FormulaC12H13NO3S
Molecular Weight251.31 g/mol
Exact Mass251.06
IUPAC Name(2R,4R)-3-acetyl-2-phenyl-1,3-thiazolidine-4-carboxylic acid
SMILESCC(=O)N1[C@@H](c2ccccc2)SC[C@H]1C(=O)O
InChIInChI=1S/C12H13NO3S/c1-8(14)13-10(12(15)16)7-17-11(13)9-5-3-2-4-6-9/h2-6,10-11H,7H2,1H3,(H,15,16)/t10-,11+/m0/s1
InChIKeyNYATUQLQYZIJCY-WDEREUQCSA-N
XLogP1.73
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.31
LogP ≤ 51.73
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze (2R,4R)-3-acetyl-2-phenyl-1,3-thiazolidine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R,4R)-3-acetyl-2-phenyl-1,3-thiazolidine-4-carboxylic acid?
The IUPAC name of (2R,4R)-3-acetyl-2-phenyl-1,3-thiazolidine-4-carboxylic acid (CID 759136) is (2R,4R)-3-acetyl-2-phenyl-1,3-thiazolidine-4-carboxylic acid.
What is the SMILES notation for (2R,4R)-3-acetyl-2-phenyl-1,3-thiazolidine-4-carboxylic acid?
The canonical SMILES for (2R,4R)-3-acetyl-2-phenyl-1,3-thiazolidine-4-carboxylic acid is CC(=O)N1[C@@H](c2ccccc2)SC[C@H]1C(=O)O.
What is the InChIKey of (2R,4R)-3-acetyl-2-phenyl-1,3-thiazolidine-4-carboxylic acid?
The InChIKey is NYATUQLQYZIJCY-WDEREUQCSA-N. The full InChI is InChI=1S/C12H13NO3S/c1-8(14)13-10(12(15)16)7-17-11(13)9-5-3-2-4-6-9/h2-6,10-11H,7H2,1H3,(H,15,16)/t10-,11+/m0/s1.
What are the key properties of (2R,4R)-3-acetyl-2-phenyl-1,3-thiazolidine-4-carboxylic acid?
(2R,4R)-3-acetyl-2-phenyl-1,3-thiazolidine-4-carboxylic acid has a molecular weight of 251.31 g/mol, XLogP of 1.73, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4R)-3-acetyl-2-phenyl-1,3-thiazolidine-4-carboxylic acid is sourced from PubChem (CID 759136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).