C24H21NO3S — CID 42728478
3-(2,2-diphenylacetyl)-2-phenyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 42728478) has the molecular formula C24H21NO3S and a molecular weight of 403.50 g/mol. Its IUPAC name is 3-(2,2-diphenylacetyl)-2-phenyl-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 3-(2,2-diphenylacetyl)-2-phenyl-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 42728478 |
| Molecular Formula | C24H21NO3S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 3-(2,2-diphenylacetyl)-2-phenyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)C1CSC(c2ccccc2)N1C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H21NO3S/c26-22(21(17-10-4-1-5-11-17)18-12-6-2-7-13-18)25-20(24(27)28)16-29-23(25)19-14-8-3-9-15-19/h1-15,20-21,23H,16H2,(H,27,28) |
| InChIKey | PCZAEKKRZPFFKD-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |