C12H13NO5S — CID 90789628
(2R)-2-(3-methoxyphenyl)-1,3-thiazolidine-3,4-dicarboxylic acid (PubChem CID 90789628) has the molecular formula C12H13NO5S and a molecular weight of 283.31 g/mol. Its IUPAC name is (2R)-2-(3-methoxyphenyl)-1,3-thiazolidine-3,4-dicarboxylic acid.
| Compound Name | (2R)-2-(3-methoxyphenyl)-1,3-thiazolidine-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 90789628 |
| Molecular Formula | C12H13NO5S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | (2R)-2-(3-methoxyphenyl)-1,3-thiazolidine-3,4-dicarboxylic acid |
| SMILES | COc1cccc([C@H]2SCC(C(=O)O)N2C(=O)O)c1 |
| InChI | InChI=1S/C12H13NO5S/c1-18-8-4-2-3-7(5-8)10-13(12(16)17)9(6-19-10)11(14)15/h2-5,9-10H,6H2,1H3,(H,14,15)(H,16,17)/t9?,10-/m1/s1 |
| InChIKey | TWLGECRUYMXDMP-QVDQXJPCSA-N |
| XLogP | 1.87 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |