C10H10N2O5S — CID 91242899
(2R)-2-(1-oxidopyridin-1-ium-4-yl)-1,3-thiazolidine-3,4-dicarboxylic acid (PubChem CID 91242899) has the molecular formula C10H10N2O5S and a molecular weight of 270.27 g/mol. Its IUPAC name is (2R)-2-(1-oxidopyridin-1-ium-4-yl)-1,3-thiazolidine-3,4-dicarboxylic acid.
| Compound Name | (2R)-2-(1-oxidopyridin-1-ium-4-yl)-1,3-thiazolidine-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 91242899 |
| Molecular Formula | C10H10N2O5S |
| Molecular Weight | 270.27 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | (2R)-2-(1-oxidopyridin-1-ium-4-yl)-1,3-thiazolidine-3,4-dicarboxylic acid |
| SMILES | O=C(O)C1CS[C@H](c2cc[n+]([O-])cc2)N1C(=O)O |
| InChI | InChI=1S/C10H10N2O5S/c13-9(14)7-5-18-8(12(7)10(15)16)6-1-3-11(17)4-2-6/h1-4,7-8H,5H2,(H,13,14)(H,15,16)/t7?,8-/m1/s1 |
| InChIKey | HYJWDFLHQQXOEN-BRFYHDHCSA-N |
| XLogP | 0.50 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.27 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|