C13H13ClFNO3S — CID 42727794
3-(3-chloropropanoyl)-2-(4-fluorophenyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 42727794) has the molecular formula C13H13ClFNO3S and a molecular weight of 317.77 g/mol. Its IUPAC name is 3-(3-chloropropanoyl)-2-(4-fluorophenyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 3-(3-chloropropanoyl)-2-(4-fluorophenyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 42727794 |
| Molecular Formula | C13H13ClFNO3S |
| Molecular Weight | 317.77 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 3-(3-chloropropanoyl)-2-(4-fluorophenyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)C1CSC(c2ccc(F)cc2)N1C(=O)CCCl |
| InChI | InChI=1S/C13H13ClFNO3S/c14-6-5-11(17)16-10(13(18)19)7-20-12(16)8-1-3-9(15)4-2-8/h1-4,10,12H,5-7H2,(H,18,19) |
| InChIKey | HQXBKFDUBKHXBH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.77 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|