C13H15NO4S2 — CID 12915713
(4R)-2-(3-hydroxyphenyl)-3-(3-sulfanylpropanoyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 12915713) has the molecular formula C13H15NO4S2 and a molecular weight of 313.40 g/mol. Its IUPAC name is (4R)-2-(3-hydroxyphenyl)-3-(3-sulfanylpropanoyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4R)-2-(3-hydroxyphenyl)-3-(3-sulfanylpropanoyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 12915713 |
| Molecular Formula | C13H15NO4S2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | (4R)-2-(3-hydroxyphenyl)-3-(3-sulfanylpropanoyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CSC(c2cccc(O)c2)N1C(=O)CCS |
| InChI | InChI=1S/C13H15NO4S2/c15-9-3-1-2-8(6-9)12-14(11(16)4-5-19)10(7-20-12)13(17)18/h1-3,6,10,12,15,19H,4-5,7H2,(H,17,18)/t10-,12?/m0/s1 |
| InChIKey | YSMCXAMWZOAGTK-NUHJPDEHSA-N |
| XLogP | 1.74 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|