C11H13NO3S3 — CID 12915814
(4R)-3-(3-sulfanylpropanoyl)-2-thiophen-2-yl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 12915814) has the molecular formula C11H13NO3S3 and a molecular weight of 303.43 g/mol. Its IUPAC name is (4R)-3-(3-sulfanylpropanoyl)-2-thiophen-2-yl-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4R)-3-(3-sulfanylpropanoyl)-2-thiophen-2-yl-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 12915814 |
| Molecular Formula | C11H13NO3S3 |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | (4R)-3-(3-sulfanylpropanoyl)-2-thiophen-2-yl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CSC(c2cccs2)N1C(=O)CCS |
| InChI | InChI=1S/C11H13NO3S3/c13-9(3-4-16)12-7(11(14)15)6-18-10(12)8-2-1-5-17-8/h1-2,5,7,10,16H,3-4,6H2,(H,14,15)/t7-,10?/m0/s1 |
| InChIKey | LUQSASOPGDLIBN-BYDSUWOYSA-N |
| XLogP | 2.10 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|