C20H20ClNO4S — CID 42728854
3-(3-chloropropanoyl)-2-(4-phenylmethoxyphenyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 42728854) has the molecular formula C20H20ClNO4S and a molecular weight of 405.90 g/mol. Its IUPAC name is 3-(3-chloropropanoyl)-2-(4-phenylmethoxyphenyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 3-(3-chloropropanoyl)-2-(4-phenylmethoxyphenyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 42728854 |
| Molecular Formula | C20H20ClNO4S |
| Molecular Weight | 405.90 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 3-(3-chloropropanoyl)-2-(4-phenylmethoxyphenyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)C1CSC(c2ccc(OCc3ccccc3)cc2)N1C(=O)CCCl |
| InChI | InChI=1S/C20H20ClNO4S/c21-11-10-18(23)22-17(20(24)25)13-27-19(22)15-6-8-16(9-7-15)26-12-14-4-2-1-3-5-14/h1-9,17,19H,10-13H2,(H,24,25) |
| InChIKey | QUSHCOYFCBTKIC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.90 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|