C21H23NO4S — CID 42728488
3-(4-butoxybenzoyl)-2-phenyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 42728488) has the molecular formula C21H23NO4S and a molecular weight of 385.49 g/mol. Its IUPAC name is 3-(4-butoxybenzoyl)-2-phenyl-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 3-(4-butoxybenzoyl)-2-phenyl-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 42728488 |
| Molecular Formula | C21H23NO4S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 3-(4-butoxybenzoyl)-2-phenyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CCCCOc1ccc(C(=O)N2C(C(=O)O)CSC2c2ccccc2)cc1 |
| InChI | InChI=1S/C21H23NO4S/c1-2-3-13-26-17-11-9-15(10-12-17)19(23)22-18(21(24)25)14-27-20(22)16-7-5-4-6-8-16/h4-12,18,20H,2-3,13-14H2,1H3,(H,24,25) |
| InChIKey | CAUGUXAWZJODDJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|