C19H27NO3S — CID 7296605
butyl (2S,4R)-3-pentanoyl-2-phenyl-1,3-thiazolidine-4-carboxylate (PubChem CID 7296605) has the molecular formula C19H27NO3S and a molecular weight of 349.50 g/mol. Its IUPAC name is butyl (2S,4R)-3-pentanoyl-2-phenyl-1,3-thiazolidine-4-carboxylate.
| Compound Name | butyl (2S,4R)-3-pentanoyl-2-phenyl-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 7296605 |
| Molecular Formula | C19H27NO3S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | butyl (2S,4R)-3-pentanoyl-2-phenyl-1,3-thiazolidine-4-carboxylate |
| SMILES | CCCCOC(=O)[C@@H]1CS[C@@H](c2ccccc2)N1C(=O)CCCC |
| InChI | InChI=1S/C19H27NO3S/c1-3-5-12-17(21)20-16(19(22)23-13-6-4-2)14-24-18(20)15-10-8-7-9-11-15/h7-11,16,18H,3-6,12-14H2,1-2H3/t16-,18-/m0/s1 |
| InChIKey | YGJTUTLWOQQCPO-WMZOPIPTSA-N |
| XLogP | 4.16 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|