C23H24ClNO3S — CID 42744574
butyl 2-(2-chlorophenyl)-3-[(E)-3-phenylprop-2-enoyl]-1,3-thiazolidine-4-carboxylate (PubChem CID 42744574) has the molecular formula C23H24ClNO3S and a molecular weight of 429.97 g/mol. Its IUPAC name is butyl 2-(2-chlorophenyl)-3-[(E)-3-phenylprop-2-enoyl]-1,3-thiazolidine-4-carboxylate.
| Compound Name | butyl 2-(2-chlorophenyl)-3-[(E)-3-phenylprop-2-enoyl]-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 42744574 |
| Molecular Formula | C23H24ClNO3S |
| Molecular Weight | 429.97 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | butyl 2-(2-chlorophenyl)-3-[(E)-3-phenylprop-2-enoyl]-1,3-thiazolidine-4-carboxylate |
| SMILES | CCCCOC(=O)C1CSC(c2ccccc2Cl)N1C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C23H24ClNO3S/c1-2-3-15-28-23(27)20-16-29-22(18-11-7-8-12-19(18)24)25(20)21(26)14-13-17-9-5-4-6-10-17/h4-14,20,22H,2-3,15-16H2,1H3/b14-13+ |
| InChIKey | JNCAYFIKZBACBT-BUHFOSPRSA-N |
| XLogP | 5.34 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.97 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|