C20H28ClNO3S — CID 7482437
propan-2-yl (2S,4R)-2-(2-chlorophenyl)-3-heptanoyl-1,3-thiazolidine-4-carboxylate (PubChem CID 7482437) has the molecular formula C20H28ClNO3S and a molecular weight of 397.97 g/mol. Its IUPAC name is propan-2-yl (2S,4R)-2-(2-chlorophenyl)-3-heptanoyl-1,3-thiazolidine-4-carboxylate.
| Compound Name | propan-2-yl (2S,4R)-2-(2-chlorophenyl)-3-heptanoyl-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 7482437 |
| Molecular Formula | C20H28ClNO3S |
| Molecular Weight | 397.97 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | propan-2-yl (2S,4R)-2-(2-chlorophenyl)-3-heptanoyl-1,3-thiazolidine-4-carboxylate |
| SMILES | CCCCCCC(=O)N1[C@H](C(=O)OC(C)C)CS[C@H]1c1ccccc1Cl |
| InChI | InChI=1S/C20H28ClNO3S/c1-4-5-6-7-12-18(23)22-17(20(24)25-14(2)3)13-26-19(22)15-10-8-9-11-16(15)21/h8-11,14,17,19H,4-7,12-13H2,1-3H3/t17-,19-/m0/s1 |
| InChIKey | MHCMXZWCNDSPFT-HKUYNNGSSA-N |
| XLogP | 5.20 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.97 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|