C18H25ClN2O3S — CID 7232108
(2R,4R)-2-(2-chlorophenyl)-3-(2-methoxyacetyl)-N-pentyl-1,3-thiazolidine-4-carboxamide (PubChem CID 7232108) has the molecular formula C18H25ClN2O3S and a molecular weight of 384.93 g/mol. Its IUPAC name is (2R,4R)-2-(2-chlorophenyl)-3-(2-methoxyacetyl)-N-pentyl-1,3-thiazolidine-4-carboxamide.
| Compound Name | (2R,4R)-2-(2-chlorophenyl)-3-(2-methoxyacetyl)-N-pentyl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 7232108 |
| Molecular Formula | C18H25ClN2O3S |
| Molecular Weight | 384.93 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | (2R,4R)-2-(2-chlorophenyl)-3-(2-methoxyacetyl)-N-pentyl-1,3-thiazolidine-4-carboxamide |
| SMILES | CCCCCNC(=O)[C@@H]1CS[C@H](c2ccccc2Cl)N1C(=O)COC |
| InChI | InChI=1S/C18H25ClN2O3S/c1-3-4-7-10-20-17(23)15-12-25-18(21(15)16(22)11-24-2)13-8-5-6-9-14(13)19/h5-6,8-9,15,18H,3-4,7,10-12H2,1-2H3,(H,20,23)/t15-,18+/m0/s1 |
| InChIKey | SUPOFZPABMJORZ-MAUKXSAKSA-N |
| XLogP | 3.24 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.93 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|