C19H28N2O4S — CID 5002325
N-butyl-2-(3,4-dimethoxyphenyl)-3-propanoyl-1,3-thiazolidine-4-carboxamide (PubChem CID 5002325) has the molecular formula C19H28N2O4S and a molecular weight of 380.51 g/mol. Its IUPAC name is N-butyl-2-(3,4-dimethoxyphenyl)-3-propanoyl-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-butyl-2-(3,4-dimethoxyphenyl)-3-propanoyl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 5002325 |
| Molecular Formula | C19H28N2O4S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | N-butyl-2-(3,4-dimethoxyphenyl)-3-propanoyl-1,3-thiazolidine-4-carboxamide |
| SMILES | CCCCNC(=O)C1CSC(c2ccc(OC)c(OC)c2)N1C(=O)CC |
| InChI | InChI=1S/C19H28N2O4S/c1-5-7-10-20-18(23)14-12-26-19(21(14)17(22)6-2)13-8-9-15(24-3)16(11-13)25-4/h8-9,11,14,19H,5-7,10,12H2,1-4H3,(H,20,23) |
| InChIKey | MAKPOJZCQPTDNH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|