C18H25FN2O2S — CID 4542958
3-acetyl-2-(3-fluorophenyl)-N-hexyl-1,3-thiazolidine-4-carboxamide (PubChem CID 4542958) has the molecular formula C18H25FN2O2S and a molecular weight of 352.48 g/mol. Its IUPAC name is 3-acetyl-2-(3-fluorophenyl)-N-hexyl-1,3-thiazolidine-4-carboxamide.
| Compound Name | 3-acetyl-2-(3-fluorophenyl)-N-hexyl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 4542958 |
| Molecular Formula | C18H25FN2O2S |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 3-acetyl-2-(3-fluorophenyl)-N-hexyl-1,3-thiazolidine-4-carboxamide |
| SMILES | CCCCCCNC(=O)C1CSC(c2cccc(F)c2)N1C(C)=O |
| InChI | InChI=1S/C18H25FN2O2S/c1-3-4-5-6-10-20-17(23)16-12-24-18(21(16)13(2)22)14-8-7-9-15(19)11-14/h7-9,11,16,18H,3-6,10,12H2,1-2H3,(H,20,23) |
| InChIKey | UHCUJFXWKHKGOT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|