C22H25FN2O2S — CID 7337817
(2S,4R)-N-butyl-2-(3-fluorophenyl)-3-(3-methylbenzoyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 7337817) has the molecular formula C22H25FN2O2S and a molecular weight of 400.52 g/mol. Its IUPAC name is (2S,4R)-N-butyl-2-(3-fluorophenyl)-3-(3-methylbenzoyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | (2S,4R)-N-butyl-2-(3-fluorophenyl)-3-(3-methylbenzoyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 7337817 |
| Molecular Formula | C22H25FN2O2S |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | (2S,4R)-N-butyl-2-(3-fluorophenyl)-3-(3-methylbenzoyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CCCCNC(=O)[C@@H]1CS[C@@H](c2cccc(F)c2)N1C(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C22H25FN2O2S/c1-3-4-11-24-20(26)19-14-28-22(17-9-6-10-18(23)13-17)25(19)21(27)16-8-5-7-15(2)12-16/h5-10,12-13,19,22H,3-4,11,14H2,1-2H3,(H,24,26)/t19-,22-/m0/s1 |
| InChIKey | NVFJAEWJEVSTNE-UGKGYDQZSA-N |
| XLogP | 4.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|