C24H29FN2O2S — CID 7288637
(2S,4R)-2-(4-fluorophenyl)-N-hexyl-3-(4-methylbenzoyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 7288637) has the molecular formula C24H29FN2O2S and a molecular weight of 428.57 g/mol. Its IUPAC name is (2S,4R)-2-(4-fluorophenyl)-N-hexyl-3-(4-methylbenzoyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | (2S,4R)-2-(4-fluorophenyl)-N-hexyl-3-(4-methylbenzoyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 7288637 |
| Molecular Formula | C24H29FN2O2S |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | (2S,4R)-2-(4-fluorophenyl)-N-hexyl-3-(4-methylbenzoyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CCCCCCNC(=O)[C@@H]1CS[C@@H](c2ccc(F)cc2)N1C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H29FN2O2S/c1-3-4-5-6-15-26-22(28)21-16-30-24(19-11-13-20(25)14-12-19)27(21)23(29)18-9-7-17(2)8-10-18/h7-14,21,24H,3-6,15-16H2,1-2H3,(H,26,28)/t21-,24-/m0/s1 |
| InChIKey | BXQMSXISZRVQNC-URXFXBBRSA-N |
| XLogP | 5.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|