C23H27FN2O2S — CID 42744453
N-(4-fluorophenyl)-3-(4-methylbenzoyl)-2-pentyl-1,3-thiazolidine-4-carboxamide (PubChem CID 42744453) has the molecular formula C23H27FN2O2S and a molecular weight of 414.55 g/mol. Its IUPAC name is N-(4-fluorophenyl)-3-(4-methylbenzoyl)-2-pentyl-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(4-fluorophenyl)-3-(4-methylbenzoyl)-2-pentyl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 42744453 |
| Molecular Formula | C23H27FN2O2S |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | N-(4-fluorophenyl)-3-(4-methylbenzoyl)-2-pentyl-1,3-thiazolidine-4-carboxamide |
| SMILES | CCCCCC1SCC(C(=O)Nc2ccc(F)cc2)N1C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H27FN2O2S/c1-3-4-5-6-21-26(23(28)17-9-7-16(2)8-10-17)20(15-29-21)22(27)25-19-13-11-18(24)12-14-19/h7-14,20-21H,3-6,15H2,1-2H3,(H,25,27) |
| InChIKey | SBJOIAINKBMUQK-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|