C17H22FNO3S — CID 42729361
methyl 3-(3-fluorobenzoyl)-2-pentyl-1,3-thiazolidine-4-carboxylate (PubChem CID 42729361) has the molecular formula C17H22FNO3S and a molecular weight of 339.43 g/mol. Its IUPAC name is methyl 3-(3-fluorobenzoyl)-2-pentyl-1,3-thiazolidine-4-carboxylate.
| Compound Name | methyl 3-(3-fluorobenzoyl)-2-pentyl-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 42729361 |
| Molecular Formula | C17H22FNO3S |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | methyl 3-(3-fluorobenzoyl)-2-pentyl-1,3-thiazolidine-4-carboxylate |
| SMILES | CCCCCC1SCC(C(=O)OC)N1C(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C17H22FNO3S/c1-3-4-5-9-15-19(14(11-23-15)17(21)22-2)16(20)12-7-6-8-13(18)10-12/h6-8,10,14-15H,3-5,9,11H2,1-2H3 |
| InChIKey | WICJAOZEHLHOHH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|