C16H29NO3S — CID 42729354
methyl 3-(3,3-dimethylbutanoyl)-2-pentyl-1,3-thiazolidine-4-carboxylate (PubChem CID 42729354) has the molecular formula C16H29NO3S and a molecular weight of 315.48 g/mol. Its IUPAC name is methyl 3-(3,3-dimethylbutanoyl)-2-pentyl-1,3-thiazolidine-4-carboxylate.
| Compound Name | methyl 3-(3,3-dimethylbutanoyl)-2-pentyl-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 42729354 |
| Molecular Formula | C16H29NO3S |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | methyl 3-(3,3-dimethylbutanoyl)-2-pentyl-1,3-thiazolidine-4-carboxylate |
| SMILES | CCCCCC1SCC(C(=O)OC)N1C(=O)CC(C)(C)C |
| InChI | InChI=1S/C16H29NO3S/c1-6-7-8-9-14-17(13(18)10-16(2,3)4)12(11-21-14)15(19)20-5/h12,14H,6-11H2,1-5H3 |
| InChIKey | HXLKIIDTGLTBOE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|