C15H21NO3S2 — CID 42729353
methyl 2-pentyl-3-(thiophene-2-carbonyl)-1,3-thiazolidine-4-carboxylate (PubChem CID 42729353) has the molecular formula C15H21NO3S2 and a molecular weight of 327.47 g/mol. Its IUPAC name is methyl 2-pentyl-3-(thiophene-2-carbonyl)-1,3-thiazolidine-4-carboxylate.
| Compound Name | methyl 2-pentyl-3-(thiophene-2-carbonyl)-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 42729353 |
| Molecular Formula | C15H21NO3S2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | methyl 2-pentyl-3-(thiophene-2-carbonyl)-1,3-thiazolidine-4-carboxylate |
| SMILES | CCCCCC1SCC(C(=O)OC)N1C(=O)c1cccs1 |
| InChI | InChI=1S/C15H21NO3S2/c1-3-4-5-8-13-16(11(10-21-13)15(18)19-2)14(17)12-7-6-9-20-12/h6-7,9,11,13H,3-5,8,10H2,1-2H3 |
| InChIKey | SVDDUDDRALDOOC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|