C23H27ClN2O2S — CID 42744445
N-benzyl-3-(2-chlorobenzoyl)-2-pentyl-1,3-thiazolidine-4-carboxamide (PubChem CID 42744445) has the molecular formula C23H27ClN2O2S and a molecular weight of 431.00 g/mol. Its IUPAC name is N-benzyl-3-(2-chlorobenzoyl)-2-pentyl-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-benzyl-3-(2-chlorobenzoyl)-2-pentyl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 42744445 |
| Molecular Formula | C23H27ClN2O2S |
| Molecular Weight | 431.00 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | N-benzyl-3-(2-chlorobenzoyl)-2-pentyl-1,3-thiazolidine-4-carboxamide |
| SMILES | CCCCCC1SCC(C(=O)NCc2ccccc2)N1C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C23H27ClN2O2S/c1-2-3-5-14-21-26(23(28)18-12-8-9-13-19(18)24)20(16-29-21)22(27)25-15-17-10-6-4-7-11-17/h4,6-13,20-21H,2-3,5,14-16H2,1H3,(H,25,27) |
| InChIKey | CJSFUFNZEOFOBX-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.00 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|