C27H36N2O5S — CID 42744456
2-pentyl-N-(2-phenylethyl)-3-(3,4,5-trimethoxybenzoyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 42744456) has the molecular formula C27H36N2O5S and a molecular weight of 500.66 g/mol. Its IUPAC name is 2-pentyl-N-(2-phenylethyl)-3-(3,4,5-trimethoxybenzoyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | 2-pentyl-N-(2-phenylethyl)-3-(3,4,5-trimethoxybenzoyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 42744456 |
| Molecular Formula | C27H36N2O5S |
| Molecular Weight | 500.66 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | 2-pentyl-N-(2-phenylethyl)-3-(3,4,5-trimethoxybenzoyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CCCCCC1SCC(C(=O)NCCc2ccccc2)N1C(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C27H36N2O5S/c1-5-6-8-13-24-29(27(31)20-16-22(32-2)25(34-4)23(17-20)33-3)21(18-35-24)26(30)28-15-14-19-11-9-7-10-12-19/h7,9-12,16-17,21,24H,5-6,8,13-15,18H2,1-4H3,(H,28,30) |
| InChIKey | SIWWEGBDHPSLPG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.66 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|