C28H38N2O5S — CID 42749107
N-butyl-2-(4-tert-butylphenyl)-3-(3,4,5-trimethoxybenzoyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 42749107) has the molecular formula C28H38N2O5S and a molecular weight of 514.69 g/mol. Its IUPAC name is N-butyl-2-(4-tert-butylphenyl)-3-(3,4,5-trimethoxybenzoyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-butyl-2-(4-tert-butylphenyl)-3-(3,4,5-trimethoxybenzoyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 42749107 |
| Molecular Formula | C28H38N2O5S |
| Molecular Weight | 514.69 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | N-butyl-2-(4-tert-butylphenyl)-3-(3,4,5-trimethoxybenzoyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CCCCNC(=O)C1CSC(c2ccc(C(C)(C)C)cc2)N1C(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C28H38N2O5S/c1-8-9-14-29-25(31)21-17-36-27(18-10-12-20(13-11-18)28(2,3)4)30(21)26(32)19-15-22(33-5)24(35-7)23(16-19)34-6/h10-13,15-16,21,27H,8-9,14,17H2,1-7H3,(H,29,31) |
| InChIKey | BYJSSFLSCBTUCG-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.69 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|